C25H40N4O7 — CID 90455586
tert-butyl N-[4-[[(5S)-5-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-6-oxoheptyl]carbamoyl]phenyl]carbamate (PubChem CID 90455586) has the molecular formula C25H40N4O7 and a molecular weight of 508.62 g/mol. Its IUPAC name is tert-butyl N-[4-[[(5S)-5-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-6-oxoheptyl]carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(5S)-5-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-6-oxoheptyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 90455586 |
| Molecular Formula | C25H40N4O7 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | tert-butyl N-[4-[[(5S)-5-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-6-oxoheptyl]carbamoyl]phenyl]carbamate |
| SMILES | CC(=O)[C@H](CCCCNC(=O)c1ccc(NC(=O)OC(C)(C)C)cc1)NC(=O)COCCOCCN |
| InChI | InChI=1S/C25H40N4O7/c1-18(30)21(29-22(31)17-35-16-15-34-14-12-26)7-5-6-13-27-23(32)19-8-10-20(11-9-19)28-24(33)36-25(2,3)4/h8-11,21H,5-7,12-17,26H2,1-4H3,(H,27,32)(H,28,33)(H,29,31)/t21-/m0/s1 |
| InChIKey | UFXVZRUZVMYKFA-NRFANRHFSA-N |
| XLogP | 2.00 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|