C26H43N5O3 — CID 91547578
N-[5-[[5-(methylamino)-6-oxoheptanoyl]amino]-6-methyliminoheptyl]-4-(propylamino)benzamide (PubChem CID 91547578) has the molecular formula C26H43N5O3 and a molecular weight of 473.66 g/mol. Its IUPAC name is N-[5-[[5-(methylamino)-6-oxoheptanoyl]amino]-6-methyliminoheptyl]-4-(propylamino)benzamide.
| Compound Name | N-[5-[[5-(methylamino)-6-oxoheptanoyl]amino]-6-methyliminoheptyl]-4-(propylamino)benzamide |
|---|---|
| PubChem CID | 91547578 |
| Molecular Formula | C26H43N5O3 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.34 |
| IUPAC Name | N-[5-[[5-(methylamino)-6-oxoheptanoyl]amino]-6-methyliminoheptyl]-4-(propylamino)benzamide |
| SMILES | CCCNc1ccc(C(=O)NCCCCC(NC(=O)CCCC(NC)C(C)=O)/C(C)=N/C)cc1 |
| InChI | InChI=1S/C26H43N5O3/c1-6-17-29-22-15-13-21(14-16-22)26(34)30-18-8-7-10-23(19(2)27-4)31-25(33)12-9-11-24(28-5)20(3)32/h13-16,23-24,28-29H,6-12,17-18H2,1-5H3,(H,30,34)(H,31,33)/b27-19+ |
| InChIKey | PHHDSNMPJPYSIO-ZXVVBBHZSA-N |
| XLogP | 3.33 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|