C23H39N5O5 — CID 143937289
N-butyl-4-(propylamino)benzamide;2-(methylamino)-5-[[2-(methylamino)-2-oxoethyl]amino]-5-oxopentanoic acid (PubChem CID 143937289) has the molecular formula C23H39N5O5 and a molecular weight of 465.60 g/mol. Its IUPAC name is N-butyl-4-(propylamino)benzamide;2-(methylamino)-5-[[2-(methylamino)-2-oxoethyl]amino]-5-oxopentanoic acid.
| Compound Name | N-butyl-4-(propylamino)benzamide;2-(methylamino)-5-[[2-(methylamino)-2-oxoethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 143937289 |
| Molecular Formula | C23H39N5O5 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | N-butyl-4-(propylamino)benzamide;2-(methylamino)-5-[[2-(methylamino)-2-oxoethyl]amino]-5-oxopentanoic acid |
| SMILES | CCCCNC(=O)c1ccc(NCCC)cc1.CNC(=O)CNC(=O)CCC(NC)C(=O)O |
| InChI | InChI=1S/C14H22N2O.C9H17N3O4/c1-3-5-11-16-14(17)12-6-8-13(9-7-12)15-10-4-2;1-10-6(9(15)16)3-4-7(13)12-5-8(14)11-2/h6-9,15H,3-5,10-11H2,1-2H3,(H,16,17);6,10H,3-5H2,1-2H3,(H,11,14)(H,12,13)(H,15,16) |
| InChIKey | DURSOTCTTLNYLW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 148.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|