C30H35NO6 — CID 90911205
N-benzyl-1-phenylmethanamine;(E)-6-(4-methoxyphenyl)-2-methylhex-3-enoic acid;oxaldehydic acid (PubChem CID 90911205) has the molecular formula C30H35NO6 and a molecular weight of 505.61 g/mol. Its IUPAC name is N-benzyl-1-phenylmethanamine;(E)-6-(4-methoxyphenyl)-2-methylhex-3-enoic acid;oxaldehydic acid.
| Compound Name | N-benzyl-1-phenylmethanamine;(E)-6-(4-methoxyphenyl)-2-methylhex-3-enoic acid;oxaldehydic acid |
|---|---|
| PubChem CID | 90911205 |
| Molecular Formula | C30H35NO6 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | N-benzyl-1-phenylmethanamine;(E)-6-(4-methoxyphenyl)-2-methylhex-3-enoic acid;oxaldehydic acid |
| SMILES | COc1ccc(CC/C=C/C(C)C(=O)O)cc1.O=CC(=O)O.c1ccc(CNCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H15N.C14H18O3.C2H2O3/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-11(14(15)16)5-3-4-6-12-7-9-13(17-2)10-8-12;3-1-2(4)5/h1-10,15H,11-12H2;3,5,7-11H,4,6H2,1-2H3,(H,15,16);1H,(H,4,5)/b;5-3+; |
| InChIKey | XDEWLTLLBIEFQG-PTDWBMLLSA-N |
| XLogP | 5.15 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|