C15H27NO3 — CID 91562631
ethane;2-[(4-methoxyphenyl)methylamino]propanoic acid (PubChem CID 91562631) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is ethane;2-[(4-methoxyphenyl)methylamino]propanoic acid.
| Compound Name | ethane;2-[(4-methoxyphenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 91562631 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | ethane;2-[(4-methoxyphenyl)methylamino]propanoic acid |
| SMILES | CC.CC.COc1ccc(CNC(C)C(=O)O)cc1 |
| InChI | InChI=1S/C11H15NO3.2C2H6/c1-8(11(13)14)12-7-9-3-5-10(15-2)6-4-9;2*1-2/h3-6,8,12H,7H2,1-2H3,(H,13,14);2*1-2H3 |
| InChIKey | BNUSTOGEYUDESA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |