C11H12F3NO3 — CID 83194888
(2S)-2-[[4-(trifluoromethoxy)phenyl]methylamino]propanoic acid (PubChem CID 83194888) has the molecular formula C11H12F3NO3 and a molecular weight of 263.21 g/mol. Its IUPAC name is (2S)-2-[[4-(trifluoromethoxy)phenyl]methylamino]propanoic acid.
| Compound Name | (2S)-2-[[4-(trifluoromethoxy)phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 83194888 |
| Molecular Formula | C11H12F3NO3 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (2S)-2-[[4-(trifluoromethoxy)phenyl]methylamino]propanoic acid |
| SMILES | C[C@H](NCc1ccc(OC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C11H12F3NO3/c1-7(10(16)17)15-6-8-2-4-9(5-3-8)18-11(12,13)14/h2-5,7,15H,6H2,1H3,(H,16,17)/t7-/m0/s1 |
| InChIKey | UFRJNEYRVOVDTH-ZETCQYMHSA-N |
| XLogP | 2.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |