C13H16F3NO3 — CID 134162201
2-methyl-3-[[4-(trifluoromethoxy)phenyl]methylamino]butanoic acid (PubChem CID 134162201) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-methyl-3-[[4-(trifluoromethoxy)phenyl]methylamino]butanoic acid.
| Compound Name | 2-methyl-3-[[4-(trifluoromethoxy)phenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 134162201 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-methyl-3-[[4-(trifluoromethoxy)phenyl]methylamino]butanoic acid |
| SMILES | CC(NCc1ccc(OC(F)(F)F)cc1)C(C)C(=O)O |
| InChI | InChI=1S/C13H16F3NO3/c1-8(12(18)19)9(2)17-7-10-3-5-11(6-4-10)20-13(14,15)16/h3-6,8-9,17H,7H2,1-2H3,(H,18,19) |
| InChIKey | WPCHOWBKROUVBA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |