C14H19F3N2O2 — CID 115576057
N-propan-2-yl-2-[[4-(trifluoromethoxy)phenyl]methylamino]propanamide (PubChem CID 115576057) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is N-propan-2-yl-2-[[4-(trifluoromethoxy)phenyl]methylamino]propanamide.
| Compound Name | N-propan-2-yl-2-[[4-(trifluoromethoxy)phenyl]methylamino]propanamide |
|---|---|
| PubChem CID | 115576057 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-propan-2-yl-2-[[4-(trifluoromethoxy)phenyl]methylamino]propanamide |
| SMILES | CC(C)NC(=O)C(C)NCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3N2O2/c1-9(2)19-13(20)10(3)18-8-11-4-6-12(7-5-11)21-14(15,16)17/h4-7,9-10,18H,8H2,1-3H3,(H,19,20) |
| InChIKey | AIENEYMUCROZHH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |