C13H16F3NO3 — CID 134162198
3-[[4-(trifluoromethoxy)phenyl]methylamino]pentanoic acid (PubChem CID 134162198) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is 3-[[4-(trifluoromethoxy)phenyl]methylamino]pentanoic acid.
| Compound Name | 3-[[4-(trifluoromethoxy)phenyl]methylamino]pentanoic acid |
|---|---|
| PubChem CID | 134162198 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-[[4-(trifluoromethoxy)phenyl]methylamino]pentanoic acid |
| SMILES | CCC(CC(=O)O)NCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H16F3NO3/c1-2-10(7-12(18)19)17-8-9-3-5-11(6-4-9)20-13(14,15)16/h3-6,10,17H,2,7-8H2,1H3,(H,18,19) |
| InChIKey | PUXMOKPUDYABEL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |