C33H64O6Si — CID 90060256
tert-butyl (E,2R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-11-(2-heptyl-1,3-dioxolan-2-yl)-2-hydroxyundec-4-enoate (PubChem CID 90060256) has the molecular formula C33H64O6Si and a molecular weight of 584.96 g/mol. Its IUPAC name is tert-butyl (E,2R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-11-(2-heptyl-1,3-dioxolan-2-yl)-2-hydroxyundec-4-enoate.
| Compound Name | tert-butyl (E,2R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-11-(2-heptyl-1,3-dioxolan-2-yl)-2-hydroxyundec-4-enoate |
|---|---|
| PubChem CID | 90060256 |
| Molecular Formula | C33H64O6Si |
| Molecular Weight | 584.96 g/mol |
| Exact Mass | 584.45 |
| IUPAC Name | tert-butyl (E,2R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-11-(2-heptyl-1,3-dioxolan-2-yl)-2-hydroxyundec-4-enoate |
| SMILES | CCCCCCCC1(CCCCCC/C=C/C[C@@](O)(CCO[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C)OCCO1 |
| InChI | InChI=1S/C33H64O6Si/c1-10-11-12-16-20-23-33(36-27-28-37-33)24-21-18-15-13-14-17-19-22-32(35,29(34)39-30(2,3)4)25-26-38-40(8,9)31(5,6)7/h17,19,35H,10-16,18,20-28H2,1-9H3/b19-17+/t32-/m1/s1 |
| InChIKey | FDBCCTQVJKHSEC-CSJUJRMBSA-N |
| XLogP | 8.86 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.96 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|