C34H62O9 — CID 70857469
ditert-butyl 2-[(E,1S)-9-(2-heptyl-1,3-dioxolan-2-yl)-1-hydroxynon-2-enyl]-2-(2-hydroxypropan-2-yloxy)butanedioate (PubChem CID 70857469) has the molecular formula C34H62O9 and a molecular weight of 614.86 g/mol. Its IUPAC name is ditert-butyl 2-[(E,1S)-9-(2-heptyl-1,3-dioxolan-2-yl)-1-hydroxynon-2-enyl]-2-(2-hydroxypropan-2-yloxy)butanedioate.
| Compound Name | ditert-butyl 2-[(E,1S)-9-(2-heptyl-1,3-dioxolan-2-yl)-1-hydroxynon-2-enyl]-2-(2-hydroxypropan-2-yloxy)butanedioate |
|---|---|
| PubChem CID | 70857469 |
| Molecular Formula | C34H62O9 |
| Molecular Weight | 614.86 g/mol |
| Exact Mass | 614.44 |
| IUPAC Name | ditert-butyl 2-[(E,1S)-9-(2-heptyl-1,3-dioxolan-2-yl)-1-hydroxynon-2-enyl]-2-(2-hydroxypropan-2-yloxy)butanedioate |
| SMILES | CCCCCCCC1(CCCCCC/C=C/[C@H](O)C(CC(=O)OC(C)(C)C)(OC(C)(C)O)C(=O)OC(C)(C)C)OCCO1 |
| InChI | InChI=1S/C34H62O9/c1-10-11-12-16-19-22-33(39-24-25-40-33)23-20-17-14-13-15-18-21-27(35)34(43-32(8,9)38,29(37)42-31(5,6)7)26-28(36)41-30(2,3)4/h18,21,27,35,38H,10-17,19-20,22-26H2,1-9H3/b21-18+/t27-,34?/m0/s1 |
| InChIKey | WRHQSEZQYQXCDF-FAMRFEOHSA-N |
| XLogP | 6.91 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.86 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|