C24H46O3Si — CID 101246567
tert-butyl (E,2S)-2-[(E,1S)-1-hydroxyhex-2-enyl]-2-(trimethylsilylmethyl)dec-3-enoate (PubChem CID 101246567) has the molecular formula C24H46O3Si and a molecular weight of 410.72 g/mol. Its IUPAC name is tert-butyl (E,2S)-2-[(E,1S)-1-hydroxyhex-2-enyl]-2-(trimethylsilylmethyl)dec-3-enoate.
| Compound Name | tert-butyl (E,2S)-2-[(E,1S)-1-hydroxyhex-2-enyl]-2-(trimethylsilylmethyl)dec-3-enoate |
|---|---|
| PubChem CID | 101246567 |
| Molecular Formula | C24H46O3Si |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | tert-butyl (E,2S)-2-[(E,1S)-1-hydroxyhex-2-enyl]-2-(trimethylsilylmethyl)dec-3-enoate |
| SMILES | CCC/C=C/[C@H](O)[C@](/C=C/CCCCCC)(C[Si](C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H46O3Si/c1-9-11-13-14-15-17-19-24(20-28(6,7)8,21(25)18-16-12-10-2)22(26)27-23(3,4)5/h16-19,21,25H,9-15,20H2,1-8H3/b18-16+,19-17+/t21-,24-/m0/s1 |
| InChIKey | LSONACLADNGSEF-IPWNXYSGSA-N |
| XLogP | 6.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|