C10H17F3O — CID 14319405
(Z,2R)-1,1,1-trifluorodec-3-en-2-ol (PubChem CID 14319405) has the molecular formula C10H17F3O and a molecular weight of 210.24 g/mol. Its IUPAC name is (Z,2R)-1,1,1-trifluorodec-3-en-2-ol.
| Compound Name | (Z,2R)-1,1,1-trifluorodec-3-en-2-ol |
|---|---|
| PubChem CID | 14319405 |
| Molecular Formula | C10H17F3O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (Z,2R)-1,1,1-trifluorodec-3-en-2-ol |
| SMILES | CCCCCC/C=C\[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C10H17F3O/c1-2-3-4-5-6-7-8-9(14)10(11,12)13/h7-9,14H,2-6H2,1H3/b8-7-/t9-/m1/s1 |
| InChIKey | GLMBFAPVTJXOAT-UFGYOYAJSA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|