C12H24O — CID 10465011
(E,2S,3S)-3-methylundec-4-en-2-ol (PubChem CID 10465011) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is (E,2S,3S)-3-methylundec-4-en-2-ol.
| Compound Name | (E,2S,3S)-3-methylundec-4-en-2-ol |
|---|---|
| PubChem CID | 10465011 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | (E,2S,3S)-3-methylundec-4-en-2-ol |
| SMILES | CCCCCC/C=C/[C@H](C)[C@H](C)O |
| InChI | InChI=1S/C12H24O/c1-4-5-6-7-8-9-10-11(2)12(3)13/h9-13H,4-8H2,1-3H3/b10-9+/t11-,12-/m0/s1 |
| InChIKey | XMWMDELDMBCSMP-GSGCRYEPSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|