About undec-3-en-2-ol
undec-3-en-2-ol (PubChem CID 174515693) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is undec-3-en-2-ol.
Molecular Properties
| Compound Name | undec-3-en-2-ol |
| PubChem CID | 174515693 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | undec-3-en-2-ol |
| SMILES | CCCCCCCC=CC(C)O |
| InChI | InChI=1S/C11H22O/c1-3-4-5-6-7-8-9-10-11(2)12/h9-12H,3-8H2,1-2H3 |
| InChIKey | JGFSMQNCDSUWBM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze undec-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undec-3-en-2-ol?
The IUPAC name of undec-3-en-2-ol (CID 174515693) is undec-3-en-2-ol.
What is the SMILES notation for undec-3-en-2-ol?
The canonical SMILES for undec-3-en-2-ol is CCCCCCCC=CC(C)O.
What is the InChIKey of undec-3-en-2-ol?
The InChIKey is JGFSMQNCDSUWBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O/c1-3-4-5-6-7-8-9-10-11(2)12/h9-12H,3-8H2,1-2H3.
What are the key properties of undec-3-en-2-ol?
undec-3-en-2-ol has a molecular weight of 170.30 g/mol, XLogP of 3.28, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for undec-3-en-2-ol is sourced from PubChem (CID 174515693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).