C18H38N2O2 — CID 140541829
(E,2R,3R)-1,2-diaminooctadec-4-ene-1,3-diol (PubChem CID 140541829) has the molecular formula C18H38N2O2 and a molecular weight of 314.51 g/mol. Its IUPAC name is (E,2R,3R)-1,2-diaminooctadec-4-ene-1,3-diol.
| Compound Name | (E,2R,3R)-1,2-diaminooctadec-4-ene-1,3-diol |
|---|---|
| PubChem CID | 140541829 |
| Molecular Formula | C18H38N2O2 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.29 |
| IUPAC Name | (E,2R,3R)-1,2-diaminooctadec-4-ene-1,3-diol |
| SMILES | CCCCCCCCCCCCC/C=C/[C@@H](O)[C@@H](N)C(N)O |
| InChI | InChI=1S/C18H38N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(21)17(19)18(20)22/h14-18,21-22H,2-13,19-20H2,1H3/b15-14+/t16-,17-,18?/m1/s1 |
| InChIKey | WSJFFWIHIALGBE-DPMPQEADSA-N |
| XLogP | 3.21 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|