C20H39NO3 — CID 154364345
(4R,5R)-4-amino-3,5-dihydroxyicos-6-en-2-one (PubChem CID 154364345) has the molecular formula C20H39NO3 and a molecular weight of 341.54 g/mol. Its IUPAC name is (4R,5R)-4-amino-3,5-dihydroxyicos-6-en-2-one.
| Compound Name | (4R,5R)-4-amino-3,5-dihydroxyicos-6-en-2-one |
|---|---|
| PubChem CID | 154364345 |
| Molecular Formula | C20H39NO3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.29 |
| IUPAC Name | (4R,5R)-4-amino-3,5-dihydroxyicos-6-en-2-one |
| SMILES | CCCCCCCCCCCCCC=C[C@@H](O)[C@@H](N)C(O)C(C)=O |
| InChI | InChI=1S/C20H39NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18(23)19(21)20(24)17(2)22/h15-16,18-20,23-24H,3-14,21H2,1-2H3/t18-,19-,20?/m1/s1 |
| InChIKey | VAUPHDNKIOCTJR-LEAGNCFPSA-N |
| XLogP | 3.88 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|