C18H35NO2 — CID 139024678
(E,2R,3R)-2-amino-3-hydroxyoctadec-4-enal (PubChem CID 139024678) has the molecular formula C18H35NO2 and a molecular weight of 297.48 g/mol. Its IUPAC name is (E,2R,3R)-2-amino-3-hydroxyoctadec-4-enal.
| Compound Name | (E,2R,3R)-2-amino-3-hydroxyoctadec-4-enal |
|---|---|
| PubChem CID | 139024678 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | (E,2R,3R)-2-amino-3-hydroxyoctadec-4-enal |
| SMILES | CCCCCCCCCCCCC/C=C/[C@@H](O)[C@@H](N)C=O |
| InChI | InChI=1S/C18H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h14-18,21H,2-13,19H2,1H3/b15-14+/t17-,18+/m0/s1 |
| InChIKey | ANIADVFLXYZTEX-KRWOKUGFSA-N |
| XLogP | 4.13 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|