C18H36FNO — CID 87803016
(E,2S,3R)-2-amino-1-fluorooctadec-4-en-3-ol (PubChem CID 87803016) has the molecular formula C18H36FNO and a molecular weight of 301.49 g/mol. Its IUPAC name is (E,2S,3R)-2-amino-1-fluorooctadec-4-en-3-ol.
| Compound Name | (E,2S,3R)-2-amino-1-fluorooctadec-4-en-3-ol |
|---|---|
| PubChem CID | 87803016 |
| Molecular Formula | C18H36FNO |
| Molecular Weight | 301.49 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | (E,2S,3R)-2-amino-1-fluorooctadec-4-en-3-ol |
| SMILES | CCCCCCCCCCCCC/C=C/[C@@H](O)[C@H](N)CF |
| InChI | InChI=1S/C18H36FNO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(20)16-19/h14-15,17-18,21H,2-13,16,20H2,1H3/b15-14+/t17-,18-/m1/s1 |
| InChIKey | HQXBWUOEWTUFST-NVGHFZOBSA-N |
| XLogP | 4.90 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|