C18H35NO2 — CID 42608343
(2S,3R,4E,14Z)-2-aminooctadeca-4,14-diene-1,3-diol (PubChem CID 42608343) has the molecular formula C18H35NO2 and a molecular weight of 297.48 g/mol. Its IUPAC name is (2S,3R,4E,14Z)-2-aminooctadeca-4,14-diene-1,3-diol.
| Compound Name | (2S,3R,4E,14Z)-2-aminooctadeca-4,14-diene-1,3-diol |
|---|---|
| PubChem CID | 42608343 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | (2S,3R,4E,14Z)-2-aminooctadeca-4,14-diene-1,3-diol |
| SMILES | CCC/C=C\CCCCCCCC/C=C/[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C18H35NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h4-5,14-15,17-18,20-21H,2-3,6-13,16,19H2,1H3/b5-4-,15-14+/t17-,18+/m0/s1 |
| InChIKey | KWDXKYNWAKMLKK-YQDZIVAPSA-N |
| XLogP | 3.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|