C19H37NO2 — CID 91332697
(2R,3S)-2-amino-9-methyloctadeca-4,8-diene-1,3-diol (PubChem CID 91332697) has the molecular formula C19H37NO2 and a molecular weight of 311.51 g/mol. Its IUPAC name is (2R,3S)-2-amino-9-methyloctadeca-4,8-diene-1,3-diol.
| Compound Name | (2R,3S)-2-amino-9-methyloctadeca-4,8-diene-1,3-diol |
|---|---|
| PubChem CID | 91332697 |
| Molecular Formula | C19H37NO2 |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.28 |
| IUPAC Name | (2R,3S)-2-amino-9-methyloctadeca-4,8-diene-1,3-diol |
| SMILES | CCCCCCCCCC(C)=CCCC=C[C@H](O)[C@H](N)CO |
| InChI | InChI=1S/C19H37NO2/c1-3-4-5-6-7-8-10-13-17(2)14-11-9-12-15-19(22)18(20)16-21/h12,14-15,18-19,21-22H,3-11,13,16,20H2,1-2H3/t18-,19+/m1/s1 |
| InChIKey | QCUHPIBMMDIRKL-MOPGFXCFSA-N |
| XLogP | 4.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|