C15H31NO2 — CID 91886102
(E,2S,3R)-2-aminopentadec-4-ene-1,3-diol (PubChem CID 91886102) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is (E,2S,3R)-2-aminopentadec-4-ene-1,3-diol.
| Compound Name | (E,2S,3R)-2-aminopentadec-4-ene-1,3-diol |
|---|---|
| PubChem CID | 91886102 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | (E,2S,3R)-2-aminopentadec-4-ene-1,3-diol |
| SMILES | CCCCCCCCCC/C=C/[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C15H31NO2/c1-2-3-4-5-6-7-8-9-10-11-12-15(18)14(16)13-17/h11-12,14-15,17-18H,2-10,13,16H2,1H3/b12-11+/t14-,15+/m0/s1 |
| InChIKey | KWQIYZIHZCLRSR-AMXOMPAFSA-N |
| XLogP | 2.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|