C20H45N2O5P — CID 175557375
2-aminoethylphosphonic acid;(E)-2-aminooctadec-4-ene-1,3-diol (PubChem CID 175557375) has the molecular formula C20H45N2O5P and a molecular weight of 424.56 g/mol. Its IUPAC name is 2-aminoethylphosphonic acid;(E)-2-aminooctadec-4-ene-1,3-diol.
| Compound Name | 2-aminoethylphosphonic acid;(E)-2-aminooctadec-4-ene-1,3-diol |
|---|---|
| PubChem CID | 175557375 |
| Molecular Formula | C20H45N2O5P |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.31 |
| IUPAC Name | 2-aminoethylphosphonic acid;(E)-2-aminooctadec-4-ene-1,3-diol |
| SMILES | CCCCCCCCCCCCC/C=C/C(O)C(N)CO.NCCP(=O)(O)O |
| InChI | InChI=1S/C18H37NO2.C2H8NO3P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20;3-1-2-7(4,5)6/h14-15,17-18,20-21H,2-13,16,19H2,1H3;1-3H2,(H2,4,5,6)/b15-14+; |
| InChIKey | SOATXTBHFLENQH-WPDLWGESSA-N |
| XLogP | 3.05 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|