C17H35NO2 — CID 42608345
(E,2S,3R)-2-amino-15-methylhexadec-4-ene-1,3-diol (PubChem CID 42608345) has the molecular formula C17H35NO2 and a molecular weight of 285.47 g/mol. Its IUPAC name is (E,2S,3R)-2-amino-15-methylhexadec-4-ene-1,3-diol.
| Compound Name | (E,2S,3R)-2-amino-15-methylhexadec-4-ene-1,3-diol |
|---|---|
| PubChem CID | 42608345 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | (E,2S,3R)-2-amino-15-methylhexadec-4-ene-1,3-diol |
| SMILES | CC(C)CCCCCCCCC/C=C/[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C17H35NO2/c1-15(2)12-10-8-6-4-3-5-7-9-11-13-17(20)16(18)14-19/h11,13,15-17,19-20H,3-10,12,14,18H2,1-2H3/b13-11+/t16-,17+/m0/s1 |
| InChIKey | LZKPPSAEINBHRP-KORIGIIASA-N |
| XLogP | 3.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|