C12H21NO2 — CID 129125807
(2S,3R,4E,8E,10E)-2-aminododeca-4,8,10-triene-1,3-diol (PubChem CID 129125807) has the molecular formula C12H21NO2 and a molecular weight of 211.31 g/mol. Its IUPAC name is (2S,3R,4E,8E,10E)-2-aminododeca-4,8,10-triene-1,3-diol.
| Compound Name | (2S,3R,4E,8E,10E)-2-aminododeca-4,8,10-triene-1,3-diol |
|---|---|
| PubChem CID | 129125807 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (2S,3R,4E,8E,10E)-2-aminododeca-4,8,10-triene-1,3-diol |
| SMILES | C/C=C/C=C/CC/C=C/[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C12H21NO2/c1-2-3-4-5-6-7-8-9-12(15)11(13)10-14/h2-5,8-9,11-12,14-15H,6-7,10,13H2,1H3/b3-2+,5-4+,9-8+/t11-,12+/m0/s1 |
| InChIKey | MVESIHXHWHQPMC-ZHVCHZDCSA-N |
| XLogP | 1.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|