C19H35NO2 — CID 129125806
(2S,3R,4E,8E,10E)-2-amino-12,14,14-trimethylhexadeca-4,8,10-triene-1,3-diol (PubChem CID 129125806) has the molecular formula C19H35NO2 and a molecular weight of 309.49 g/mol. Its IUPAC name is (2S,3R,4E,8E,10E)-2-amino-12,14,14-trimethylhexadeca-4,8,10-triene-1,3-diol.
| Compound Name | (2S,3R,4E,8E,10E)-2-amino-12,14,14-trimethylhexadeca-4,8,10-triene-1,3-diol |
|---|---|
| PubChem CID | 129125806 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | (2S,3R,4E,8E,10E)-2-amino-12,14,14-trimethylhexadeca-4,8,10-triene-1,3-diol |
| SMILES | CCC(C)(C)CC(C)/C=C/C=C/CC/C=C/[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C19H35NO2/c1-5-19(3,4)14-16(2)12-10-8-6-7-9-11-13-18(22)17(20)15-21/h6,8,10-13,16-18,21-22H,5,7,9,14-15,20H2,1-4H3/b8-6+,12-10+,13-11+/t16?,17-,18+/m0/s1 |
| InChIKey | JKVLYHNQEXIHGL-RIBOMXRUSA-N |
| XLogP | 3.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|