C11H20O — CID 129408350
(3S,4Z)-undeca-1,4-dien-3-ol (PubChem CID 129408350) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (3S,4Z)-undeca-1,4-dien-3-ol.
| Compound Name | (3S,4Z)-undeca-1,4-dien-3-ol |
|---|---|
| PubChem CID | 129408350 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (3S,4Z)-undeca-1,4-dien-3-ol |
| SMILES | C=C[C@H](O)/C=C\CCCCCC |
| InChI | InChI=1S/C11H20O/c1-3-5-6-7-8-9-10-11(12)4-2/h4,9-12H,2-3,5-8H2,1H3/b10-9-/t11-/m0/s1 |
| InChIKey | JYOVMDPIGLTFMW-JUDLJHIGSA-N |
| XLogP | 3.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|