C17H26O — CID 15736263
(4E,9Z)-heptadeca-1,4,9-trien-6-yn-3-ol (PubChem CID 15736263) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is (4E,9Z)-heptadeca-1,4,9-trien-6-yn-3-ol.
| Compound Name | (4E,9Z)-heptadeca-1,4,9-trien-6-yn-3-ol |
|---|---|
| PubChem CID | 15736263 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (4E,9Z)-heptadeca-1,4,9-trien-6-yn-3-ol |
| SMILES | C=CC(O)/C=C/C#CC/C=C\CCCCCCC |
| InChI | InChI=1S/C17H26O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17(18)4-2/h4,10-11,15-18H,2-3,5-9,12H2,1H3/b11-10-,16-15+ |
| InChIKey | AZYMFOSYSFSUMW-JXNPCESCSA-N |
| XLogP | 4.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|