C34H48O4 — CID 87532668
(3R,8S,9Z)-heptadeca-1,9-dien-4,6-diyne-3,8-diol;(3R,8S,9E)-heptadeca-1,9-dien-4,6-diyne-3,8-diol (PubChem CID 87532668) has the molecular formula C34H48O4 and a molecular weight of 520.75 g/mol. Its IUPAC name is (3R,8S,9Z)-heptadeca-1,9-dien-4,6-diyne-3,8-diol;(3R,8S,9E)-heptadeca-1,9-dien-4,6-diyne-3,8-diol.
| Compound Name | (3R,8S,9Z)-heptadeca-1,9-dien-4,6-diyne-3,8-diol;(3R,8S,9E)-heptadeca-1,9-dien-4,6-diyne-3,8-diol |
|---|---|
| PubChem CID | 87532668 |
| Molecular Formula | C34H48O4 |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.36 |
| IUPAC Name | (3R,8S,9Z)-heptadeca-1,9-dien-4,6-diyne-3,8-diol;(3R,8S,9E)-heptadeca-1,9-dien-4,6-diyne-3,8-diol |
| SMILES | C=C[C@@H](O)C#CC#C[C@@H](O)/C=C/CCCCCCC.C=C[C@@H](O)C#CC#C[C@@H](O)/C=C\CCCCCCC |
| InChI | InChI=1S/2C17H24O2/c2*1-3-5-6-7-8-9-10-14-17(19)15-12-11-13-16(18)4-2/h2*4,10,14,16-19H,2-3,5-9H2,1H3/b14-10+;14-10-/t2*16-,17+/m11/s1 |
| InChIKey | RDTGJMJOAMBMLX-GNVQCQCISA-N |
| XLogP | 5.64 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|