C25H40O2 — CID 11245738
(6R,7E,16Z)-pentacosa-7,16-dien-2,4-diyne-1,6-diol (PubChem CID 11245738) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is (6R,7E,16Z)-pentacosa-7,16-dien-2,4-diyne-1,6-diol.
| Compound Name | (6R,7E,16Z)-pentacosa-7,16-dien-2,4-diyne-1,6-diol |
|---|---|
| PubChem CID | 11245738 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | (6R,7E,16Z)-pentacosa-7,16-dien-2,4-diyne-1,6-diol |
| SMILES | CCCCCCCC/C=C\CCCCCCC/C=C/[C@@H](O)C#CC#CCO |
| InChI | InChI=1S/C25H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-22-25(27)23-20-18-21-24-26/h9-10,19,22,25-27H,2-8,11-17,24H2,1H3/b10-9-,22-19+/t25-/m1/s1 |
| InChIKey | OQJJHNNWSRRUMI-VUWBONDSSA-N |
| XLogP | 5.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|