C23H40O — CID 163109025
tricosa-4,16-dien-1-yn-3-ol (PubChem CID 163109025) has the molecular formula C23H40O and a molecular weight of 332.57 g/mol. Its IUPAC name is tricosa-4,16-dien-1-yn-3-ol.
| Compound Name | tricosa-4,16-dien-1-yn-3-ol |
|---|---|
| PubChem CID | 163109025 |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.31 |
| IUPAC Name | tricosa-4,16-dien-1-yn-3-ol |
| SMILES | C#CC(O)C=CCCCCCCCCCCC=CCCCCCC |
| InChI | InChI=1S/C23H40O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)4-2/h2,9-10,21-24H,3,5-8,11-20H2,1H3 |
| InChIKey | GMKXFOBLGFINJP-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|