C23H42O — CID 10382264
(E,3R)-14-methyldocos-4-en-1-yn-3-ol (PubChem CID 10382264) has the molecular formula C23H42O and a molecular weight of 334.59 g/mol. Its IUPAC name is (E,3R)-14-methyldocos-4-en-1-yn-3-ol.
| Compound Name | (E,3R)-14-methyldocos-4-en-1-yn-3-ol |
|---|---|
| PubChem CID | 10382264 |
| Molecular Formula | C23H42O |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.32 |
| IUPAC Name | (E,3R)-14-methyldocos-4-en-1-yn-3-ol |
| SMILES | C#C[C@H](O)/C=C/CCCCCCCCC(C)CCCCCCCC |
| InChI | InChI=1S/C23H42O/c1-4-6-7-8-13-16-19-22(3)20-17-14-11-9-10-12-15-18-21-23(24)5-2/h2,18,21-24H,4,6-17,19-20H2,1,3H3/b21-18+/t22?,23-/m0/s1 |
| InChIKey | OJSONOXLRPJULC-TVVHOIPDSA-N |
| XLogP | 7.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|