C32H50O2 — CID 53262797
(3R,4E,11E,17E,28E,30R)-dotriaconta-4,11,17,28-tetraen-1,31-diyne-3,30-diol (PubChem CID 53262797) has the molecular formula C32H50O2 and a molecular weight of 466.75 g/mol. Its IUPAC name is (3R,4E,11E,17E,28E,30R)-dotriaconta-4,11,17,28-tetraen-1,31-diyne-3,30-diol.
| Compound Name | (3R,4E,11E,17E,28E,30R)-dotriaconta-4,11,17,28-tetraen-1,31-diyne-3,30-diol |
|---|---|
| PubChem CID | 53262797 |
| Molecular Formula | C32H50O2 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.38 |
| IUPAC Name | (3R,4E,11E,17E,28E,30R)-dotriaconta-4,11,17,28-tetraen-1,31-diyne-3,30-diol |
| SMILES | C#C[C@H](O)/C=C/CCCCC/C=C/CCCC/C=C/CCCCCCCCC/C=C/[C@@H](O)C#C |
| InChI | InChI=1S/C32H50O2/c1-3-31(33)29-27-25-23-21-19-17-15-13-11-9-7-5-6-8-10-12-14-16-18-20-22-24-26-28-30-32(34)4-2/h1-2,5,7,14,16,27-34H,6,8-13,15,17-26H2/b7-5+,16-14+,29-27+,30-28+/t31-,32-/m0/s1 |
| InChIKey | ILEBLZYXEWLOSI-HWWUBVHNSA-N |
| XLogP | 8.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|