C30H48O2 — CID 162943596
(3R,4E,26E,28R)-triaconta-4,15,26-trien-1,29-diyne-3,28-diol (PubChem CID 162943596) has the molecular formula C30H48O2 and a molecular weight of 440.71 g/mol. Its IUPAC name is (3R,4E,26E,28R)-triaconta-4,15,26-trien-1,29-diyne-3,28-diol.
| Compound Name | (3R,4E,26E,28R)-triaconta-4,15,26-trien-1,29-diyne-3,28-diol |
|---|---|
| PubChem CID | 162943596 |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | (3R,4E,26E,28R)-triaconta-4,15,26-trien-1,29-diyne-3,28-diol |
| SMILES | C#C[C@H](O)/C=C/CCCCCCCCCC=CCCCCCCCCC/C=C/[C@@H](O)C#C |
| InChI | InChI=1S/C30H48O2/c1-3-29(31)27-25-23-21-19-17-15-13-11-9-7-5-6-8-10-12-14-16-18-20-22-24-26-28-30(32)4-2/h1-2,5-6,25-32H,7-24H2/b6-5?,27-25+,28-26+/t29-,30-/m0/s1 |
| InChIKey | XFALGIQXDHGEPT-YSNVMZNKSA-N |
| XLogP | 7.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|