C22H38O — CID 163029238
(3S,4E)-docosa-4,15-dien-1-yn-3-ol (PubChem CID 163029238) has the molecular formula C22H38O and a molecular weight of 318.55 g/mol. Its IUPAC name is (3S,4E)-docosa-4,15-dien-1-yn-3-ol.
| Compound Name | (3S,4E)-docosa-4,15-dien-1-yn-3-ol |
|---|---|
| PubChem CID | 163029238 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | (3S,4E)-docosa-4,15-dien-1-yn-3-ol |
| SMILES | C#C[C@@H](O)/C=C/CCCCCCCCCC=CCCCCCC |
| InChI | InChI=1S/C22H38O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)4-2/h2,9-10,20-23H,3,5-8,11-19H2,1H3/b10-9?,21-20+/t22-/m1/s1 |
| InChIKey | HEXQBSKJVUFXNG-NVMCEKFISA-N |
| XLogP | 6.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|