C17H22O2 — CID 162870727
(8S)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one (PubChem CID 162870727) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (8S)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one.
| Compound Name | (8S)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one |
|---|---|
| PubChem CID | 162870727 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (8S)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one |
| SMILES | C=CC(=O)C#CC#C[C@@H](O)C=CCCCCCCC |
| InChI | InChI=1S/C17H22O2/c1-3-5-6-7-8-9-10-14-17(19)15-12-11-13-16(18)4-2/h4,10,14,17,19H,2-3,5-9H2,1H3/t17-/m0/s1 |
| InChIKey | STNWZOBISHHDCD-KRWDZBQOSA-N |
| XLogP | 3.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|