C17H24O3 — CID 71405899
(8S)-heptadeca-9,16-dien-4,6-diyne-2,3,8-triol (PubChem CID 71405899) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (8S)-heptadeca-9,16-dien-4,6-diyne-2,3,8-triol.
| Compound Name | (8S)-heptadeca-9,16-dien-4,6-diyne-2,3,8-triol |
|---|---|
| PubChem CID | 71405899 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (8S)-heptadeca-9,16-dien-4,6-diyne-2,3,8-triol |
| SMILES | C=CCCCCCC=C[C@H](O)C#CC#CC(O)C(C)O |
| InChI | InChI=1S/C17H24O3/c1-3-4-5-6-7-8-9-12-16(19)13-10-11-14-17(20)15(2)18/h3,9,12,15-20H,1,4-8H2,2H3/t15?,16-,17?/m0/s1 |
| InChIKey | BEZRAMBFCSSHHE-CGZBRXJRSA-N |
| XLogP | 1.79 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|