C18H26O3 — CID 102004534
(9Z,11S,16R)-octadeca-9,17-dien-12,14-diyne-1,11,16-triol (PubChem CID 102004534) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (9Z,11S,16R)-octadeca-9,17-dien-12,14-diyne-1,11,16-triol.
| Compound Name | (9Z,11S,16R)-octadeca-9,17-dien-12,14-diyne-1,11,16-triol |
|---|---|
| PubChem CID | 102004534 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (9Z,11S,16R)-octadeca-9,17-dien-12,14-diyne-1,11,16-triol |
| SMILES | C=C[C@@H](O)C#CC#C[C@@H](O)/C=C\CCCCCCCCO |
| InChI | InChI=1S/C18H26O3/c1-2-17(20)13-10-11-15-18(21)14-9-7-5-3-4-6-8-12-16-19/h2,9,14,17-21H,1,3-8,12,16H2/b14-9-/t17-,18+/m1/s1 |
| InChIKey | MLGPZCOVWKAPPH-BEMCDONGSA-N |
| XLogP | 2.18 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|