C15H18O2 — CID 162974276
(3S,8S,9E)-pentadeca-1,9,14-trien-4,6-diyne-3,8-diol (PubChem CID 162974276) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (3S,8S,9E)-pentadeca-1,9,14-trien-4,6-diyne-3,8-diol.
| Compound Name | (3S,8S,9E)-pentadeca-1,9,14-trien-4,6-diyne-3,8-diol |
|---|---|
| PubChem CID | 162974276 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (3S,8S,9E)-pentadeca-1,9,14-trien-4,6-diyne-3,8-diol |
| SMILES | C=CCCC/C=C/[C@H](O)C#CC#C[C@@H](O)C=C |
| InChI | InChI=1S/C15H18O2/c1-3-5-6-7-8-12-15(17)13-10-9-11-14(16)4-2/h3-4,8,12,14-17H,1-2,5-7H2/b12-8+/t14-,15-/m0/s1 |
| InChIKey | UUSIZIHJVGSKEU-BWSMEOODSA-N |
| XLogP | 1.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|