C17H20O — CID 6442009
(3R,9Z,11Z)-heptadeca-1,9,11,16-tetraen-4,6-diyn-3-ol (PubChem CID 6442009) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is (3R,9Z,11Z)-heptadeca-1,9,11,16-tetraen-4,6-diyn-3-ol.
| Compound Name | (3R,9Z,11Z)-heptadeca-1,9,11,16-tetraen-4,6-diyn-3-ol |
|---|---|
| PubChem CID | 6442009 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (3R,9Z,11Z)-heptadeca-1,9,11,16-tetraen-4,6-diyn-3-ol |
| SMILES | C=CCCC/C=C\C=C/CC#CC#C[C@H](O)C=C |
| InChI | InChI=1S/C17H20O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17(18)4-2/h3-4,8-11,17-18H,1-2,5-7,12H2/b9-8-,11-10-/t17-/m1/s1 |
| InChIKey | ADKVNLJOJPLERM-GMBPKHMRSA-N |
| XLogP | 3.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|