C13H16O — CID 10726292
(9E)-trideca-1,9-dien-4,6-diyn-3-ol (PubChem CID 10726292) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is (9E)-trideca-1,9-dien-4,6-diyn-3-ol.
| Compound Name | (9E)-trideca-1,9-dien-4,6-diyn-3-ol |
|---|---|
| PubChem CID | 10726292 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (9E)-trideca-1,9-dien-4,6-diyn-3-ol |
| SMILES | C=CC(O)C#CC#CC/C=C/CCC |
| InChI | InChI=1S/C13H16O/c1-3-5-6-7-8-9-10-11-12-13(14)4-2/h4,6-7,13-14H,2-3,5,8H2,1H3/b7-6+ |
| InChIKey | IMEXSTBZNSUWPH-VOTSOKGWSA-N |
| XLogP | 2.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|