C17H22O — CID 162999782
(3S,8E,10E)-heptadeca-1,8,10-trien-4,6-diyn-3-ol (PubChem CID 162999782) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is (3S,8E,10E)-heptadeca-1,8,10-trien-4,6-diyn-3-ol.
| Compound Name | (3S,8E,10E)-heptadeca-1,8,10-trien-4,6-diyn-3-ol |
|---|---|
| PubChem CID | 162999782 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (3S,8E,10E)-heptadeca-1,8,10-trien-4,6-diyn-3-ol |
| SMILES | C=C[C@H](O)C#CC#C/C=C/C=C/CCCCCC |
| InChI | InChI=1S/C17H22O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17(18)4-2/h4,9-12,17-18H,2-3,5-8H2,1H3/b10-9+,12-11+/t17-/m0/s1 |
| InChIKey | VQLVMDURNHLTBU-LKCIYOFESA-N |
| XLogP | 3.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|