C17H20O2 — CID 162849256
(3S,8E,11R,12E,14Z)-heptadeca-1,8,12,14-tetraen-4,6-diyne-3,11-diol (PubChem CID 162849256) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is (3S,8E,11R,12E,14Z)-heptadeca-1,8,12,14-tetraen-4,6-diyne-3,11-diol.
| Compound Name | (3S,8E,11R,12E,14Z)-heptadeca-1,8,12,14-tetraen-4,6-diyne-3,11-diol |
|---|---|
| PubChem CID | 162849256 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (3S,8E,11R,12E,14Z)-heptadeca-1,8,12,14-tetraen-4,6-diyne-3,11-diol |
| SMILES | C=C[C@H](O)C#CC#C/C=C/C[C@@H](O)/C=C/C=C\CC |
| InChI | InChI=1S/C17H20O2/c1-3-5-6-10-14-17(19)15-12-9-7-8-11-13-16(18)4-2/h4-6,9-10,12,14,16-19H,2-3,15H2,1H3/b6-5-,12-9+,14-10+/t16-,17-/m0/s1 |
| InChIKey | LMTILNTWHMTNFH-ZRRHQDCHSA-N |
| XLogP | 2.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|