C18H24O4 — CID 90024114
(16R)-9,16-dihydroxyoctadeca-10,17-dien-12,14-diynoic acid (PubChem CID 90024114) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is (16R)-9,16-dihydroxyoctadeca-10,17-dien-12,14-diynoic acid.
| Compound Name | (16R)-9,16-dihydroxyoctadeca-10,17-dien-12,14-diynoic acid |
|---|---|
| PubChem CID | 90024114 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (16R)-9,16-dihydroxyoctadeca-10,17-dien-12,14-diynoic acid |
| SMILES | C=C[C@@H](O)C#CC#CC=CC(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H24O4/c1-2-16(19)12-8-6-7-10-14-17(20)13-9-4-3-5-11-15-18(21)22/h2,10,14,16-17,19-20H,1,3-5,9,11,13,15H2,(H,21,22)/t16-,17?/m1/s1 |
| InChIKey | FERPWRANYSRDCY-TZHYSIJRSA-N |
| XLogP | 2.27 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|