C19H22O3 — CID 162915818
3-oxoheptadeca-1,9,16-trien-4,6-diyn-8-yl acetate (PubChem CID 162915818) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 3-oxoheptadeca-1,9,16-trien-4,6-diyn-8-yl acetate.
| Compound Name | 3-oxoheptadeca-1,9,16-trien-4,6-diyn-8-yl acetate |
|---|---|
| PubChem CID | 162915818 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 3-oxoheptadeca-1,9,16-trien-4,6-diyn-8-yl acetate |
| SMILES | C=CCCCCCC=CC(C#CC#CC(=O)C=C)OC(C)=O |
| InChI | InChI=1S/C19H22O3/c1-4-6-7-8-9-10-11-15-19(22-17(3)20)16-13-12-14-18(21)5-2/h4-5,11,15,19H,1-2,6-10H2,3H3 |
| InChIKey | OPNUFVCHEBRKQW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|