C14H14O — CID 19801350
(8E)-tetradeca-1,8,13-trien-4,6-diyn-3-one (PubChem CID 19801350) has the molecular formula C14H14O and a molecular weight of 198.26 g/mol. Its IUPAC name is (8E)-tetradeca-1,8,13-trien-4,6-diyn-3-one.
| Compound Name | (8E)-tetradeca-1,8,13-trien-4,6-diyn-3-one |
|---|---|
| PubChem CID | 19801350 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | (8E)-tetradeca-1,8,13-trien-4,6-diyn-3-one |
| SMILES | C=CCCC/C=C/C#CC#CC(=O)C=C |
| InChI | InChI=1S/C14H14O/c1-3-5-6-7-8-9-10-11-12-13-14(15)4-2/h3-4,8-9H,1-2,5-7H2/b9-8+ |
| InChIKey | UXPVJPDBRYQIPS-CMDGGOBGSA-N |
| XLogP | 2.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|