C16H17ClO — CID 23252098
(7Z,13E,15Z)-16-chlorohexadeca-7,13,15-trien-9,11-diyn-2-one (PubChem CID 23252098) has the molecular formula C16H17ClO and a molecular weight of 260.76 g/mol. Its IUPAC name is (7Z,13E,15Z)-16-chlorohexadeca-7,13,15-trien-9,11-diyn-2-one.
| Compound Name | (7Z,13E,15Z)-16-chlorohexadeca-7,13,15-trien-9,11-diyn-2-one |
|---|---|
| PubChem CID | 23252098 |
| Molecular Formula | C16H17ClO |
| Molecular Weight | 260.76 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (7Z,13E,15Z)-16-chlorohexadeca-7,13,15-trien-9,11-diyn-2-one |
| SMILES | CC(=O)CCCC/C=C\C#CC#C/C=C/C=C\Cl |
| InChI | InChI=1S/C16H17ClO/c1-16(18)14-12-10-8-6-4-2-3-5-7-9-11-13-15-17/h4,6,9,11,13,15H,8,10,12,14H2,1H3/b6-4-,11-9+,15-13- |
| InChIKey | QIGXBZBQCBMKBS-OHOUXBLXSA-N |
| XLogP | 4.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.76 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|