About (E)-1-aminodec-3-en-2-ol
(E)-1-aminodec-3-en-2-ol (PubChem CID 101275263) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is (E)-1-aminodec-3-en-2-ol.
Molecular Properties
| Compound Name | (E)-1-aminodec-3-en-2-ol |
| PubChem CID | 101275263 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (E)-1-aminodec-3-en-2-ol |
| SMILES | CCCCCC/C=C/C(O)CN |
| InChI | InChI=1S/C10H21NO/c1-2-3-4-5-6-7-8-10(12)9-11/h7-8,10,12H,2-6,9,11H2,1H3/b8-7+ |
| InChIKey | SWZVNZDTCCSXCM-BQYQJAHWSA-N |
| XLogP | 1.83 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-aminodec-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-aminodec-3-en-2-ol?
The IUPAC name of (E)-1-aminodec-3-en-2-ol (CID 101275263) is (E)-1-aminodec-3-en-2-ol.
What is the SMILES notation for (E)-1-aminodec-3-en-2-ol?
The canonical SMILES for (E)-1-aminodec-3-en-2-ol is CCCCCC/C=C/C(O)CN.
What is the InChIKey of (E)-1-aminodec-3-en-2-ol?
The InChIKey is SWZVNZDTCCSXCM-BQYQJAHWSA-N. The full InChI is InChI=1S/C10H21NO/c1-2-3-4-5-6-7-8-10(12)9-11/h7-8,10,12H,2-6,9,11H2,1H3/b8-7+.
What are the key properties of (E)-1-aminodec-3-en-2-ol?
(E)-1-aminodec-3-en-2-ol has a molecular weight of 171.28 g/mol, XLogP of 1.83, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-aminodec-3-en-2-ol is sourced from PubChem (CID 101275263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).