About 1-aminopropan-2-ol;(Z)-octadec-9-en-1-amine
1-aminopropan-2-ol;(Z)-octadec-9-en-1-amine (PubChem CID 174940034) has the molecular formula C21H46N2O
and a molecular weight of 342.61 g/mol. Its IUPAC name is 1-aminopropan-2-ol;(Z)-octadec-9-en-1-amine.
Molecular Properties
| Compound Name | 1-aminopropan-2-ol;(Z)-octadec-9-en-1-amine |
| PubChem CID | 174940034 |
| Molecular Formula | C21H46N2O |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 342.36 |
| IUPAC Name | 1-aminopropan-2-ol;(Z)-octadec-9-en-1-amine |
| SMILES | CC(O)CN.CCCCCCCC/C=C\CCCCCCCCN |
| InChI | InChI=1S/C18H37N.C3H9NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-3(5)2-4/h9-10H,2-8,11-19H2,1H3;3,5H,2,4H2,1H3/b10-9-; |
| InChIKey | IIINIHKGHZYPIA-KVVVOXFISA-N |
| XLogP | 5.31 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopropan-2-ol;(Z)-octadec-9-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropan-2-ol;(Z)-octadec-9-en-1-amine?
The IUPAC name of 1-aminopropan-2-ol;(Z)-octadec-9-en-1-amine (CID 174940034) is 1-aminopropan-2-ol;(Z)-octadec-9-en-1-amine.
What is the SMILES notation for 1-aminopropan-2-ol;(Z)-octadec-9-en-1-amine?
The canonical SMILES for 1-aminopropan-2-ol;(Z)-octadec-9-en-1-amine is CC(O)CN.CCCCCCCC/C=C\CCCCCCCCN.
What is the InChIKey of 1-aminopropan-2-ol;(Z)-octadec-9-en-1-amine?
The InChIKey is IIINIHKGHZYPIA-KVVVOXFISA-N. The full InChI is InChI=1S/C18H37N.C3H9NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-3(5)2-4/h9-10H,2-8,11-19H2,1H3;3,5H,2,4H2,1H3/b10-9-;.
What are the key properties of 1-aminopropan-2-ol;(Z)-octadec-9-en-1-amine?
1-aminopropan-2-ol;(Z)-octadec-9-en-1-amine has a molecular weight of 342.61 g/mol, XLogP of 5.31, 16 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropan-2-ol;(Z)-octadec-9-en-1-amine is sourced from PubChem (CID 174940034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).