C18H32O — CID 10468022
(6Z,10E)-8-methylideneheptadeca-6,10-dien-9-ol (PubChem CID 10468022) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is (6Z,10E)-8-methylideneheptadeca-6,10-dien-9-ol.
| Compound Name | (6Z,10E)-8-methylideneheptadeca-6,10-dien-9-ol |
|---|---|
| PubChem CID | 10468022 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | (6Z,10E)-8-methylideneheptadeca-6,10-dien-9-ol |
| SMILES | C=C(/C=C\CCCCC)C(O)/C=C/CCCCCC |
| InChI | InChI=1S/C18H32O/c1-4-6-8-10-12-14-16-18(19)17(3)15-13-11-9-7-5-2/h13-16,18-19H,3-12H2,1-2H3/b15-13-,16-14+ |
| InChIKey | XDLYZDFRFPUJLO-VCFJNTAESA-N |
| XLogP | 5.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|